C16H20N4OS — CID 94819164
(2S)-2-phenyl-N-(1H-pyrazol-5-ylmethyl)-2-thiomorpholin-4-ylacetamide (PubChem CID 94819164) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is (2S)-2-phenyl-N-(1H-pyrazol-5-ylmethyl)-2-thiomorpholin-4-ylacetamide.
| Compound Name | (2S)-2-phenyl-N-(1H-pyrazol-5-ylmethyl)-2-thiomorpholin-4-ylacetamide |
|---|---|
| PubChem CID | 94819164 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (2S)-2-phenyl-N-(1H-pyrazol-5-ylmethyl)-2-thiomorpholin-4-ylacetamide |
| SMILES | O=C(NCc1ccn[nH]1)[C@H](c1ccccc1)N1CCSCC1 |
| InChI | InChI=1S/C16H20N4OS/c21-16(17-12-14-6-7-18-19-14)15(13-4-2-1-3-5-13)20-8-10-22-11-9-20/h1-7,15H,8-12H2,(H,17,21)(H,18,19)/t15-/m0/s1 |
| InChIKey | SURFJNCXGPXHHV-HNNXBMFYSA-N |
| XLogP | 1.82 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |