C18H20F3N3O2 — CID 9482111
N-[(1R)-1-(furan-2-yl)ethyl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 9482111) has the molecular formula C18H20F3N3O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9482111 |
| Molecular Formula | C18H20F3N3O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | C[C@@H](NC(=O)C1CCN(c2ccc(C(F)(F)F)cn2)CC1)c1ccco1 |
| InChI | InChI=1S/C18H20F3N3O2/c1-12(15-3-2-10-26-15)23-17(25)13-6-8-24(9-7-13)16-5-4-14(11-22-16)18(19,20)21/h2-5,10-13H,6-9H2,1H3,(H,23,25)/t12-/m1/s1 |
| InChIKey | PLZQQMGMEMWIKA-GFCCVEGCSA-N |
| XLogP | 3.79 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |