C16H16FNO3 — CID 9482231
(E)-3-(3-fluoro-4-methoxyphenyl)-N-[(1R)-1-(furan-2-yl)ethyl]prop-2-enamide (PubChem CID 9482231) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-N-[(1R)-1-(furan-2-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[(1R)-1-(furan-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9482231 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[(1R)-1-(furan-2-yl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N[C@H](C)c2ccco2)cc1F |
| InChI | InChI=1S/C16H16FNO3/c1-11(14-4-3-9-21-14)18-16(19)8-6-12-5-7-15(20-2)13(17)10-12/h3-11H,1-2H3,(H,18,19)/b8-6+/t11-/m1/s1 |
| InChIKey | NUMAXPGBZPSNAU-LXSSAFMLSA-N |
| XLogP | 3.32 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|