C12H15N3O3S — CID 94824444
2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[(2R)-oxan-2-yl]oxyacetamide (PubChem CID 94824444) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[(2R)-oxan-2-yl]oxyacetamide.
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[(2R)-oxan-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 94824444 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[(2R)-oxan-2-yl]oxyacetamide |
| SMILES | O=C(Cc1cn2ccsc2n1)NO[C@@H]1CCCCO1 |
| InChI | InChI=1S/C12H15N3O3S/c16-10(14-18-11-3-1-2-5-17-11)7-9-8-15-4-6-19-12(15)13-9/h4,6,8,11H,1-3,5,7H2,(H,14,16)/t11-/m1/s1 |
| InChIKey | BXSIQWQCEZVTCG-LLVKDONJSA-N |
| XLogP | 1.51 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|