C21H27N3O4S — CID 9482610
N-[2-oxo-2-[[2-oxo-2-[3-(2,3,5-trimethylphenoxy)propylamino]ethyl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 9482610) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[2-oxo-2-[[2-oxo-2-[3-(2,3,5-trimethylphenoxy)propylamino]ethyl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-oxo-2-[[2-oxo-2-[3-(2,3,5-trimethylphenoxy)propylamino]ethyl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9482610 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[2-oxo-2-[[2-oxo-2-[3-(2,3,5-trimethylphenoxy)propylamino]ethyl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C)c(C)c(OCCCNC(=O)CNC(=O)CNC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H27N3O4S/c1-14-10-15(2)16(3)17(11-14)28-8-5-7-22-19(25)12-23-20(26)13-24-21(27)18-6-4-9-29-18/h4,6,9-11H,5,7-8,12-13H2,1-3H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | YEYYZRBJEONRJO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|