C12H10N4OS — CID 94830239
2-hydrazinyl-3-phenylthieno[3,2-d]pyrimidin-4-one (PubChem CID 94830239) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-hydrazinyl-3-phenylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-hydrazinyl-3-phenylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 94830239 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-hydrazinyl-3-phenylthieno[3,2-d]pyrimidin-4-one |
| SMILES | NNc1nc2ccsc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C12H10N4OS/c13-15-12-14-9-6-7-18-10(9)11(17)16(12)8-4-2-1-3-5-8/h1-7H,13H2,(H,14,15) |
| InChIKey | QWFUVKQWTBZOKP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|