C14H10Br2N4O — CID 12845265
6,8-dibromo-2-hydrazinyl-3-phenylquinazolin-4-one (PubChem CID 12845265) has the molecular formula C14H10Br2N4O and a molecular weight of 410.07 g/mol. Its IUPAC name is 6,8-dibromo-2-hydrazinyl-3-phenylquinazolin-4-one.
| Compound Name | 6,8-dibromo-2-hydrazinyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 12845265 |
| Molecular Formula | C14H10Br2N4O |
| Molecular Weight | 410.07 g/mol |
| Exact Mass | 407.92 |
| IUPAC Name | 6,8-dibromo-2-hydrazinyl-3-phenylquinazolin-4-one |
| SMILES | NNc1nc2c(Br)cc(Br)cc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C14H10Br2N4O/c15-8-6-10-12(11(16)7-8)18-14(19-17)20(13(10)21)9-4-2-1-3-5-9/h1-7H,17H2,(H,18,19) |
| InChIKey | LEFBRNDMUZLEFI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.07 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|