C14H18ClNO — CID 94830564
1-[3-chloro-4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethanone (PubChem CID 94830564) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 1-[3-chloro-4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-chloro-4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 94830564 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-[3-chloro-4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCC[C@H](C)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClNO/c1-10-4-3-7-16(9-10)14-6-5-12(11(2)17)8-13(14)15/h5-6,8,10H,3-4,7,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | KFLJMVWKHNHQRW-JTQLQIEISA-N |
| XLogP | 3.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |