C21H30N4O5 — CID 94832154
N-(2-methylpropyl)-N'-[(E)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]propanediamide (PubChem CID 94832154) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-(2-methylpropyl)-N'-[(E)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]propanediamide.
| Compound Name | N-(2-methylpropyl)-N'-[(E)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 94832154 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-(2-methylpropyl)-N'-[(E)-[4-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]propanediamide |
| SMILES | CC(C)CNC(=O)CC(=O)N/N=C/c1ccc(OCC(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C21H30N4O5/c1-15(2)11-22-19(26)10-20(27)25-24-12-16-5-7-17(8-6-16)30-14-21(28)23-13-18-4-3-9-29-18/h5-8,12,15,18H,3-4,9-11,13-14H2,1-2H3,(H,22,26)(H,23,28)(H,25,27)/b24-12+/t18-/m0/s1 |
| InChIKey | OQXVJUQPNUNCEN-AMAFCZHPSA-N |
| XLogP | 0.97 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|