C21H28N2O6 — CID 9483290
3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide (PubChem CID 9483290) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 9483290 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(CNC(=O)CCN2C(=O)[C@H]3CCCC[C@H]3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H28N2O6/c1-27-16-10-13(11-17(28-2)19(16)29-3)12-22-18(24)8-9-23-20(25)14-6-4-5-7-15(14)21(23)26/h10-11,14-15H,4-9,12H2,1-3H3,(H,22,24)/t14-,15+ |
| InChIKey | YHFXVXOVTDRKKK-GASCZTMLSA-N |
| XLogP | 1.89 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|