C26H20ClN3O4 — CID 94837531
N'-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-N-(4-phenylmethoxyphenyl)oxamide (PubChem CID 94837531) has the molecular formula C26H20ClN3O4 and a molecular weight of 473.92 g/mol. Its IUPAC name is N'-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-N-(4-phenylmethoxyphenyl)oxamide.
| Compound Name | N'-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-N-(4-phenylmethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 94837531 |
| Molecular Formula | C26H20ClN3O4 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N'-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-N-(4-phenylmethoxyphenyl)oxamide |
| SMILES | O=C(N/N=C/c1ccc(-c2cccc(Cl)c2)o1)C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H20ClN3O4/c27-20-8-4-7-19(15-20)24-14-13-23(34-24)16-28-30-26(32)25(31)29-21-9-11-22(12-10-21)33-17-18-5-2-1-3-6-18/h1-16H,17H2,(H,29,31)(H,30,32)/b28-16+ |
| InChIKey | OUFMXWGOQVHYBI-LQKURTRISA-N |
| XLogP | 5.27 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|