C28H29N5O6 — CID 94854415
(5R)-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 94854415) has the molecular formula C28H29N5O6 and a molecular weight of 531.57 g/mol. Its IUPAC name is (5R)-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 94854415 |
| Molecular Formula | C28H29N5O6 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | (5R)-4-[hydroxy-(5-methyl-1-phenylpyrazol-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1c(C(O)=C2C(=O)C(=O)N(CCCN3CCOCC3)[C@@H]2c2cccc([N+](=O)[O-])c2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C28H29N5O6/c1-19-23(18-29-32(19)21-8-3-2-4-9-21)26(34)24-25(20-7-5-10-22(17-20)33(37)38)31(28(36)27(24)35)12-6-11-30-13-15-39-16-14-30/h2-5,7-10,17-18,25,34H,6,11-16H2,1H3/t25-/m1/s1 |
| InChIKey | IRTZNZCMRYSWKK-RUZDIDTESA-N |
| XLogP | 3.23 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|