C20H19ClN4O3 — CID 9485546
[2-[[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]amino]-2-oxoethyl] 2-amino-4-chlorobenzoate (PubChem CID 9485546) has the molecular formula C20H19ClN4O3 and a molecular weight of 398.85 g/mol. Its IUPAC name is [2-[[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]amino]-2-oxoethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-[[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]amino]-2-oxoethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 9485546 |
| Molecular Formula | C20H19ClN4O3 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [2-[[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]amino]-2-oxoethyl] 2-amino-4-chlorobenzoate |
| SMILES | Cc1ccc(-n2nc(C)cc2NC(=O)COC(=O)c2ccc(Cl)cc2N)cc1 |
| InChI | InChI=1S/C20H19ClN4O3/c1-12-3-6-15(7-4-12)25-18(9-13(2)24-25)23-19(26)11-28-20(27)16-8-5-14(21)10-17(16)22/h3-10H,11,22H2,1-2H3,(H,23,26) |
| InChIKey | NUNOWBJDRLHAGM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|