C22H22F2N2O2S — CID 9486140
(5E)-2-(2,4-difluorophenyl)imino-5-[(2-ethoxyphenyl)methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one (PubChem CID 9486140) has the molecular formula C22H22F2N2O2S and a molecular weight of 416.49 g/mol. Its IUPAC name is (5E)-2-(2,4-difluorophenyl)imino-5-[(2-ethoxyphenyl)methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2,4-difluorophenyl)imino-5-[(2-ethoxyphenyl)methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 9486140 |
| Molecular Formula | C22H22F2N2O2S |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (5E)-2-(2,4-difluorophenyl)imino-5-[(2-ethoxyphenyl)methylidene]-3-(2-methylpropyl)-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccccc1/C=C1/S/C(=N\c2ccc(F)cc2F)N(CC(C)C)C1=O |
| InChI | InChI=1S/C22H22F2N2O2S/c1-4-28-19-8-6-5-7-15(19)11-20-21(27)26(13-14(2)3)22(29-20)25-18-10-9-16(23)12-17(18)24/h5-12,14H,4,13H2,1-3H3/b20-11+,25-22- |
| InChIKey | RPXFGZDWKNDTPS-RSQFKHFRSA-N |
| XLogP | 5.62 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|