C18H14F2N2O3S — CID 9486012
(5E)-2-(2,4-difluorophenyl)imino-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one (PubChem CID 9486012) has the molecular formula C18H14F2N2O3S and a molecular weight of 376.38 g/mol. Its IUPAC name is (5E)-2-(2,4-difluorophenyl)imino-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2,4-difluorophenyl)imino-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 9486012 |
| Molecular Formula | C18H14F2N2O3S |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (5E)-2-(2,4-difluorophenyl)imino-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(/C=C2/S/C(=N\c3ccc(F)cc3F)N(C)C2=O)c1O |
| InChI | InChI=1S/C18H14F2N2O3S/c1-22-17(24)15(8-10-4-3-5-14(25-2)16(10)23)26-18(22)21-13-7-6-11(19)9-12(13)20/h3-9,23H,1-2H3/b15-8+,21-18- |
| InChIKey | VOHOKNAPDOHVHL-NUFACVACSA-N |
| XLogP | 3.91 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|