C19H13F2N3O2S — CID 9486068
2-[4-[(E)-[2-(2,4-difluorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile (PubChem CID 9486068) has the molecular formula C19H13F2N3O2S and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-[4-[(E)-[2-(2,4-difluorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[(E)-[2-(2,4-difluorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 9486068 |
| Molecular Formula | C19H13F2N3O2S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-[4-[(E)-[2-(2,4-difluorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile |
| SMILES | CN1C(=O)/C(=C\c2ccc(OCC#N)cc2)S/C1=N/c1ccc(F)cc1F |
| InChI | InChI=1S/C19H13F2N3O2S/c1-24-18(25)17(10-12-2-5-14(6-3-12)26-9-8-22)27-19(24)23-16-7-4-13(20)11-15(16)21/h2-7,10-11H,9H2,1H3/b17-10+,23-19+ |
| InChIKey | CZEAAXODGUZOAY-IOCNEMAKSA-N |
| XLogP | 4.10 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|