C21H19F2N3OS — CID 8556162
(5E)-2-(2,4-difluorophenyl)imino-3-methyl-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 8556162) has the molecular formula C21H19F2N3OS and a molecular weight of 399.47 g/mol. Its IUPAC name is (5E)-2-(2,4-difluorophenyl)imino-3-methyl-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2,4-difluorophenyl)imino-3-methyl-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 8556162 |
| Molecular Formula | C21H19F2N3OS |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (5E)-2-(2,4-difluorophenyl)imino-3-methyl-5-[(4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2ccc(N3CCCC3)cc2)S/C1=N\c1ccc(F)cc1F |
| InChI | InChI=1S/C21H19F2N3OS/c1-25-20(27)19(28-21(25)24-18-9-6-15(22)13-17(18)23)12-14-4-7-16(8-5-14)26-10-2-3-11-26/h4-9,12-13H,2-3,10-11H2,1H3/b19-12+,24-21- |
| InChIKey | PXVBYJKLLJITHX-KBEOOMRJSA-N |
| XLogP | 4.80 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|