C17H11ClF2N2OS — CID 9486023
(5E)-5-[(4-chlorophenyl)methylidene]-2-(2,4-difluorophenyl)imino-3-methyl-1,3-thiazolidin-4-one (PubChem CID 9486023) has the molecular formula C17H11ClF2N2OS and a molecular weight of 364.80 g/mol. Its IUPAC name is (5E)-5-[(4-chlorophenyl)methylidene]-2-(2,4-difluorophenyl)imino-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-chlorophenyl)methylidene]-2-(2,4-difluorophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 9486023 |
| Molecular Formula | C17H11ClF2N2OS |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (5E)-5-[(4-chlorophenyl)methylidene]-2-(2,4-difluorophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2ccc(Cl)cc2)S/C1=N/c1ccc(F)cc1F |
| InChI | InChI=1S/C17H11ClF2N2OS/c1-22-16(23)15(8-10-2-4-11(18)5-3-10)24-17(22)21-14-7-6-12(19)9-13(14)20/h2-9H,1H3/b15-8+,21-17+ |
| InChIKey | ZRKYDXVCKYSSCX-HZWCKOPCSA-N |
| XLogP | 4.85 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|