C18H14F2N2O2S — CID 9485982
(5Z)-2-(2,4-difluorophenyl)imino-5-[(4-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one (PubChem CID 9485982) has the molecular formula C18H14F2N2O2S and a molecular weight of 360.39 g/mol. Its IUPAC name is (5Z)-2-(2,4-difluorophenyl)imino-5-[(4-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2,4-difluorophenyl)imino-5-[(4-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 9485982 |
| Molecular Formula | C18H14F2N2O2S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | (5Z)-2-(2,4-difluorophenyl)imino-5-[(4-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2\S/C(=N/c3ccc(F)cc3F)N(C)C2=O)cc1 |
| InChI | InChI=1S/C18H14F2N2O2S/c1-22-17(23)16(9-11-3-6-13(24-2)7-4-11)25-18(22)21-15-8-5-12(19)10-14(15)20/h3-10H,1-2H3/b16-9-,21-18+ |
| InChIKey | QDTAUCKKNLULMC-UVOJOKLUSA-N |
| XLogP | 4.21 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|