C13H13N3O2 — CID 94882190
(1S,6R)-6-([1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 94882190) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is (1S,6R)-6-([1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-([1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 94882190 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (1S,6R)-6-([1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1c1nnc2ccccn12 |
| InChI | InChI=1S/C13H13N3O2/c17-13(18)10-6-2-1-5-9(10)12-15-14-11-7-3-4-8-16(11)12/h1-4,7-10H,5-6H2,(H,17,18)/t9-,10+/m1/s1 |
| InChIKey | VIHIQTAXOBGAPX-ZJUUUORDSA-N |
| XLogP | 1.86 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|