C7H5LiN3O2 — CID 175937217
CID 175937217 (PubChem CID 175937217) has the molecular formula C7H5LiN3O2 and a molecular weight of 170.08 g/mol.
| Compound Name | CID 175937217 |
|---|---|
| PubChem CID | 175937217 |
| Molecular Formula | C7H5LiN3O2 |
| Molecular Weight | 170.08 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | — |
| SMILES | O=C(O)c1nnc2ccccn12.[Li] |
| InChI | InChI=1S/C7H5N3O2.Li/c11-7(12)6-9-8-5-3-1-2-4-10(5)6;/h1-4H,(H,11,12); |
| InChIKey | ADDRQTFXOCGEKA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.08 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |