potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate

C7H4KN3O2 — CID 153470348

IUPACpotassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate
SMILESO=C([O-])c1nnc2ccccn12.[K+]
InChIInChI=1S/C7H5N3O2.K/c11-7(12)6-9-8-5-3-1-2-4-10(5)6;/h1-4H,(H,11,12);/q;+1/p-1
InChIKeyRFVRUWVAOKPDHN-UHFFFAOYSA-M
MW201.23 g/mol
LogP-3.90
Rot. Bonds1

About potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate

potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate (PubChem CID 153470348) has the molecular formula C7H4KN3O2 and a molecular weight of 201.23 g/mol. Its IUPAC name is potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate.

Molecular Properties

Compound Namepotassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate
PubChem CID153470348
Molecular FormulaC7H4KN3O2
Molecular Weight201.23 g/mol
Exact Mass200.99
IUPAC Namepotassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate
SMILESO=C([O-])c1nnc2ccccn12.[K+]
InChIInChI=1S/C7H5N3O2.K/c11-7(12)6-9-8-5-3-1-2-4-10(5)6;/h1-4H,(H,11,12);/q;+1/p-1
InChIKeyRFVRUWVAOKPDHN-UHFFFAOYSA-M
XLogP-3.90
TPSA70.32 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.23
LogP ≤ 5-3.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate?
The IUPAC name of potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate (CID 153470348) is potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate.
What is the SMILES notation for potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate?
The canonical SMILES for potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate is O=C([O-])c1nnc2ccccn12.[K+].
What is the InChIKey of potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate?
The InChIKey is RFVRUWVAOKPDHN-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5N3O2.K/c11-7(12)6-9-8-5-3-1-2-4-10(5)6;/h1-4H,(H,11,12);/q;+1/p-1.
What are the key properties of potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate?
potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate has a molecular weight of 201.23 g/mol, XLogP of -3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate is sourced from PubChem (CID 153470348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).