C9H13N3 — CID 91210925
ethane;3-methyl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 91210925) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is ethane;3-methyl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | ethane;3-methyl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 91210925 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | ethane;3-methyl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC.Cc1nnc2ccccn12 |
| InChI | InChI=1S/C7H7N3.C2H6/c1-6-8-9-7-4-2-3-5-10(6)7;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | ABKAHODWLWFKMY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |