C8H9N3OS — CID 131165709
3-ethylsulfinyl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 131165709) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-ethylsulfinyl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-ethylsulfinyl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 131165709 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-ethylsulfinyl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CCS(=O)c1nnc2ccccn12 |
| InChI | InChI=1S/C8H9N3OS/c1-2-13(12)8-10-9-7-5-3-4-6-11(7)8/h3-6H,2H2,1H3 |
| InChIKey | SQWQKXLRYZKGGY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |