C9H9N3 — CID 68903381
3-prop-2-enyl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 68903381) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 3-prop-2-enyl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-prop-2-enyl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 68903381 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 3-prop-2-enyl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | C=CCc1nnc2ccccn12 |
| InChI | InChI=1S/C9H9N3/c1-2-5-8-10-11-9-6-3-4-7-12(8)9/h2-4,6-7H,1,5H2 |
| InChIKey | HVYXPGSCYHDZGF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|