C18H27N5O3 — CID 9488329
N-methyl-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-morpholin-4-ylpyridine-2-carboxamide (PubChem CID 9488329) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-methyl-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-morpholin-4-ylpyridine-2-carboxamide.
| Compound Name | N-methyl-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-morpholin-4-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 9488329 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | N-methyl-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-4-morpholin-4-ylpyridine-2-carboxamide |
| SMILES | CN1CCN(C(=O)CN(C)C(=O)c2cc(N3CCOCC3)ccn2)CC1 |
| InChI | InChI=1S/C18H27N5O3/c1-20-5-7-23(8-6-20)17(24)14-21(2)18(25)16-13-15(3-4-19-16)22-9-11-26-12-10-22/h3-4,13H,5-12,14H2,1-2H3 |
| InChIKey | AALVUDLQVIHPJH-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 69.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |