C13H25NS — CID 94885711
(3R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thian-3-amine (PubChem CID 94885711) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is (3R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thian-3-amine.
| Compound Name | (3R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thian-3-amine |
|---|---|
| PubChem CID | 94885711 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (3R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]thian-3-amine |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1N[C@@H]1CCCSC1 |
| InChI | InChI=1S/C13H25NS/c1-10-5-3-7-13(11(10)2)14-12-6-4-8-15-9-12/h10-14H,3-9H2,1-2H3/t10-,11-,12-,13+/m1/s1 |
| InChIKey | AQYAOALCSPRSOS-LPWJVIDDSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |