C8H15NS — CID 131110851
N-[(1R,2R)-2-methylcyclopropyl]thiolan-3-amine (PubChem CID 131110851) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclopropyl]thiolan-3-amine.
| Compound Name | N-[(1R,2R)-2-methylcyclopropyl]thiolan-3-amine |
|---|---|
| PubChem CID | 131110851 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclopropyl]thiolan-3-amine |
| SMILES | C[C@@H]1C[C@H]1NC1CCSC1 |
| InChI | InChI=1S/C8H15NS/c1-6-4-8(6)9-7-2-3-10-5-7/h6-9H,2-5H2,1H3/t6-,7?,8-/m1/s1 |
| InChIKey | GJZPAFWOBIJEGA-OECOWPMFSA-N |
| XLogP | 1.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |