C10H19NOS — CID 104926602
trans-(1R,2R)-2-(thiolan-3-ylamino)cyclohexan-1-ol (PubChem CID 104926602) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is trans-(1R,2R)-2-(thiolan-3-ylamino)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(thiolan-3-ylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 104926602 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | trans-(1R,2R)-2-(thiolan-3-ylamino)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1NC1CCSC1 |
| InChI | InChI=1S/C10H19NOS/c12-10-4-2-1-3-9(10)11-8-5-6-13-7-8/h8-12H,1-7H2/t8?,9-,10-/m1/s1 |
| InChIKey | XEIGWJGANGEUOR-VXRWAFEHSA-N |
| XLogP | 1.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |