C25H33N3O3 — CID 9488838
3,5-diacetamido-N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]benzamide (PubChem CID 9488838) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3,5-diacetamido-N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]benzamide.
| Compound Name | 3,5-diacetamido-N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 9488838 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 3,5-diacetamido-N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]benzamide |
| SMILES | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)NCCc2c(C)cc(C(C)(C)C)cc2C)c1 |
| InChI | InChI=1S/C25H33N3O3/c1-15-10-20(25(5,6)7)11-16(2)23(15)8-9-26-24(31)19-12-21(27-17(3)29)14-22(13-19)28-18(4)30/h10-14H,8-9H2,1-7H3,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | NYCDVJPAMALIQS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |