C16H23N3O3 — CID 18108250
3,5-diacetamido-N-pentylbenzamide (PubChem CID 18108250) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3,5-diacetamido-N-pentylbenzamide.
| Compound Name | 3,5-diacetamido-N-pentylbenzamide |
|---|---|
| PubChem CID | 18108250 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3,5-diacetamido-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cc(NC(C)=O)cc(NC(C)=O)c1 |
| InChI | InChI=1S/C16H23N3O3/c1-4-5-6-7-17-16(22)13-8-14(18-11(2)20)10-15(9-13)19-12(3)21/h8-10H,4-7H2,1-3H3,(H,17,22)(H,18,20)(H,19,21) |
| InChIKey | SWFOYSRYKQZRKO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|