C18H18N2O4S — CID 9488900
(3-propan-2-ylphenyl) 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate (PubChem CID 9488900) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is (3-propan-2-ylphenyl) 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate.
| Compound Name | (3-propan-2-ylphenyl) 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate |
|---|---|
| PubChem CID | 9488900 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (3-propan-2-ylphenyl) 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate |
| SMILES | CC(C)c1cccc(OC(=O)CCn2nc(-c3cccs3)oc2=O)c1 |
| InChI | InChI=1S/C18H18N2O4S/c1-12(2)13-5-3-6-14(11-13)23-16(21)8-9-20-18(22)24-17(19-20)15-7-4-10-25-15/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | KNYOZYVABDDGJN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|