C22H15FN2O5S — CID 18283481
[4-(4-fluorobenzoyl)phenyl] 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate (PubChem CID 18283481) has the molecular formula C22H15FN2O5S and a molecular weight of 438.44 g/mol. Its IUPAC name is [4-(4-fluorobenzoyl)phenyl] 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate.
| Compound Name | [4-(4-fluorobenzoyl)phenyl] 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate |
|---|---|
| PubChem CID | 18283481 |
| Molecular Formula | C22H15FN2O5S |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | [4-(4-fluorobenzoyl)phenyl] 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoate |
| SMILES | O=C(CCn1nc(-c2cccs2)oc1=O)Oc1ccc(C(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H15FN2O5S/c23-16-7-3-14(4-8-16)20(27)15-5-9-17(10-6-15)29-19(26)11-12-25-22(28)30-21(24-25)18-2-1-13-31-18/h1-10,13H,11-12H2 |
| InChIKey | LNCCJUOIHAKBLN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 91.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|