C18H17FN4O5S — CID 24567798
2-(4-fluorophenoxy)-N'-[3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoyl]propanehydrazide (PubChem CID 24567798) has the molecular formula C18H17FN4O5S and a molecular weight of 420.42 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N'-[3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoyl]propanehydrazide.
| Compound Name | 2-(4-fluorophenoxy)-N'-[3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 24567798 |
| Molecular Formula | C18H17FN4O5S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-(4-fluorophenoxy)-N'-[3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoyl]propanehydrazide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NNC(=O)CCn1nc(-c2cccs2)oc1=O |
| InChI | InChI=1S/C18H17FN4O5S/c1-11(27-13-6-4-12(19)5-7-13)16(25)21-20-15(24)8-9-23-18(26)28-17(22-23)14-3-2-10-29-14/h2-7,10-11H,8-9H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | JMNJMLHEGMEFIU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|