C19H16N6O4S — CID 24567891
N'-[3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 24567891) has the molecular formula C19H16N6O4S and a molecular weight of 424.44 g/mol. Its IUPAC name is N'-[3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24567891 |
| Molecular Formula | C19H16N6O4S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N'-[3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(CCn1nc(-c2cccs2)oc1=O)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H16N6O4S/c26-16(8-9-25-19(28)29-18(24-25)15-7-4-10-30-15)22-23-17(27)14-11-13(20-21-14)12-5-2-1-3-6-12/h1-7,10-11H,8-9H2,(H,20,21)(H,22,26)(H,23,27) |
| InChIKey | GEYSRMGWYAPTFE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|