C20H30N2O3 — CID 9489487
propan-2-yl 5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 9489487) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is propan-2-yl 5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | propan-2-yl 5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 9489487 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | propan-2-yl 5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | Cc1[nH]c(C(=O)N2CCC[C@@H]3CCCC[C@@H]32)c(C)c1C(=O)OC(C)C |
| InChI | InChI=1S/C20H30N2O3/c1-12(2)25-20(24)17-13(3)18(21-14(17)4)19(23)22-11-7-9-15-8-5-6-10-16(15)22/h12,15-16,21H,5-11H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | RONLGNMXEJOYCZ-HOTGVXAUSA-N |
| XLogP | 3.99 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |