C20H28N2O4 — CID 8579335
[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 8579335) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8579335 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)OCC(=O)N2CCC[C@@H]3CCCC[C@H]32)c1C |
| InChI | InChI=1S/C20H28N2O4/c1-12-18(14(3)23)13(2)21-19(12)20(25)26-11-17(24)22-10-6-8-15-7-4-5-9-16(15)22/h15-16,21H,4-11H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | OWMPNTPSWBXVEF-JKSUJKDBSA-N |
| XLogP | 3.17 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |