C15H21N3O3 — CID 9489542
1-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 9489542) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 9489542 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)N1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C15H21N3O3/c19-13-7-9-17(15(21)16-13)10-14(20)18-8-3-5-11-4-1-2-6-12(11)18/h7,9,11-12H,1-6,8,10H2,(H,16,19,21)/t11-,12+/m1/s1 |
| InChIKey | HJTVUJCPBGJHIU-NEPJUHHUSA-N |
| XLogP | 0.72 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |