C12H18N2O2S — CID 94909098
1-[(2S)-2-cyclopropyl-2-hydroxypropyl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 94909098) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-[(2S)-2-cyclopropyl-2-hydroxypropyl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[(2S)-2-cyclopropyl-2-hydroxypropyl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 94909098 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-[(2S)-2-cyclopropyl-2-hydroxypropyl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | C[C@@](O)(CNC(=O)NCc1cccs1)C1CC1 |
| InChI | InChI=1S/C12H18N2O2S/c1-12(16,9-4-5-9)8-14-11(15)13-7-10-3-2-6-17-10/h2-3,6,9,16H,4-5,7-8H2,1H3,(H2,13,14,15)/t12-/m1/s1 |
| InChIKey | ORTSKKSZPCWJQQ-GFCCVEGCSA-N |
| XLogP | 1.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |