C8H14N2O — CID 94915636
(3S)-N-prop-2-enylpyrrolidine-3-carboxamide (PubChem CID 94915636) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (3S)-N-prop-2-enylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-prop-2-enylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94915636 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (3S)-N-prop-2-enylpyrrolidine-3-carboxamide |
| SMILES | C=CCNC(=O)[C@H]1CCNC1 |
| InChI | InChI=1S/C8H14N2O/c1-2-4-10-8(11)7-3-5-9-6-7/h2,7,9H,1,3-6H2,(H,10,11)/t7-/m0/s1 |
| InChIKey | UIBFALWGZYLYCF-ZETCQYMHSA-N |
| XLogP | -0.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|