C8H12N2O2 — CID 126649587
(3S)-N-prop-2-enoylpyrrolidine-3-carboxamide (PubChem CID 126649587) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is (3S)-N-prop-2-enoylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-prop-2-enoylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126649587 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | (3S)-N-prop-2-enoylpyrrolidine-3-carboxamide |
| SMILES | C=CC(=O)NC(=O)[C@H]1CCNC1 |
| InChI | InChI=1S/C8H12N2O2/c1-2-7(11)10-8(12)6-3-4-9-5-6/h2,6,9H,1,3-5H2,(H,10,11,12)/t6-/m0/s1 |
| InChIKey | ZFRDTZGRMVNZNG-LURJTMIESA-N |
| XLogP | -0.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|