C18H21Cl2N3O3 — CID 9492218
N-[2-(4-tert-butylphenoxy)ethyl]-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide (PubChem CID 9492218) has the molecular formula C18H21Cl2N3O3 and a molecular weight of 398.29 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 9492218 |
| Molecular Formula | C18H21Cl2N3O3 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1 |
| InChI | InChI=1S/C18H21Cl2N3O3/c1-18(2,3)12-4-6-13(7-5-12)26-9-8-21-15(24)11-23-17(25)16(20)14(19)10-22-23/h4-7,10H,8-9,11H2,1-3H3,(H,21,24) |
| InChIKey | LGHOBJYNUIMGBP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|