C15H21N3O — CID 94933876
(4R,5R)-4-amino-1-cyclohexyl-5-pyridin-3-ylpyrrolidin-2-one (PubChem CID 94933876) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is (4R,5R)-4-amino-1-cyclohexyl-5-pyridin-3-ylpyrrolidin-2-one.
| Compound Name | (4R,5R)-4-amino-1-cyclohexyl-5-pyridin-3-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 94933876 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | (4R,5R)-4-amino-1-cyclohexyl-5-pyridin-3-ylpyrrolidin-2-one |
| SMILES | N[C@@H]1CC(=O)N(C2CCCCC2)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C15H21N3O/c16-13-9-14(19)18(12-6-2-1-3-7-12)15(13)11-5-4-8-17-10-11/h4-5,8,10,12-13,15H,1-3,6-7,9,16H2/t13-,15-/m1/s1 |
| InChIKey | DEVQHIRVQKIZIX-UKRRQHHQSA-N |
| XLogP | 2.02 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |