C19H21N3O — CID 94938536
[1-(2,4-dimethylphenyl)-5-(2-phenylethyl)triazol-4-yl]methanol (PubChem CID 94938536) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is [1-(2,4-dimethylphenyl)-5-(2-phenylethyl)triazol-4-yl]methanol.
| Compound Name | [1-(2,4-dimethylphenyl)-5-(2-phenylethyl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 94938536 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | [1-(2,4-dimethylphenyl)-5-(2-phenylethyl)triazol-4-yl]methanol |
| SMILES | Cc1ccc(-n2nnc(CO)c2CCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H21N3O/c1-14-8-10-18(15(2)12-14)22-19(17(13-23)20-21-22)11-9-16-6-4-3-5-7-16/h3-8,10,12,23H,9,11,13H2,1-2H3 |
| InChIKey | LRGOBTCVCZLIJU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |