5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid

C18H17N3O2 — CID 94940495

IUPAC5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid
SMILESCc1ccc(-n2nnc(C(=O)O)c2Cc2ccccc2)c(C)c1
InChIInChI=1S/C18H17N3O2/c1-12-8-9-15(13(2)10-12)21-16(17(18(22)23)19-20-21)11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,22,23)
InChIKeyQFUADMLNXWQFQF-UHFFFAOYSA-N
MW307.35 g/mol
LogP3.17
Rot. Bonds4

About 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid

5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid (PubChem CID 94940495) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid.

Molecular Properties

Compound Name5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid
PubChem CID94940495
Molecular FormulaC18H17N3O2
Molecular Weight307.35 g/mol
Exact Mass307.13
IUPAC Name5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid
SMILESCc1ccc(-n2nnc(C(=O)O)c2Cc2ccccc2)c(C)c1
InChIInChI=1S/C18H17N3O2/c1-12-8-9-15(13(2)10-12)21-16(17(18(22)23)19-20-21)11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,22,23)
InChIKeyQFUADMLNXWQFQF-UHFFFAOYSA-N
XLogP3.17
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.35
LogP ≤ 53.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid?
The IUPAC name of 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid (CID 94940495) is 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid.
What is the SMILES notation for 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid?
The canonical SMILES for 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid is Cc1ccc(-n2nnc(C(=O)O)c2Cc2ccccc2)c(C)c1.
What is the InChIKey of 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid?
The InChIKey is QFUADMLNXWQFQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-12-8-9-15(13(2)10-12)21-16(17(18(22)23)19-20-21)11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,22,23).
What are the key properties of 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid?
5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid has a molecular weight of 307.35 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid is sourced from PubChem (CID 94940495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).