C18H17N3O2 — CID 94940495
5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid (PubChem CID 94940495) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid.
| Compound Name | 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94940495 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 5-benzyl-1-(2,4-dimethylphenyl)triazole-4-carboxylic acid |
| SMILES | Cc1ccc(-n2nnc(C(=O)O)c2Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H17N3O2/c1-12-8-9-15(13(2)10-12)21-16(17(18(22)23)19-20-21)11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,22,23) |
| InChIKey | QFUADMLNXWQFQF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |