C19H27N3O — CID 94939880
[5-(4-butylcyclohexyl)-1-phenyltriazol-4-yl]methanol (PubChem CID 94939880) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is [5-(4-butylcyclohexyl)-1-phenyltriazol-4-yl]methanol.
| Compound Name | [5-(4-butylcyclohexyl)-1-phenyltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 94939880 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | [5-(4-butylcyclohexyl)-1-phenyltriazol-4-yl]methanol |
| SMILES | CCCCC1CCC(c2c(CO)nnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N3O/c1-2-3-7-15-10-12-16(13-11-15)19-18(14-23)20-21-22(19)17-8-5-4-6-9-17/h4-6,8-9,15-16,23H,2-3,7,10-14H2,1H3 |
| InChIKey | WUNGLEVHPQHSCO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |