C18H28N4O — CID 94944132
[5-[(2,5-dimethylphenoxy)methyl]-1-hexyltriazol-4-yl]methanamine (PubChem CID 94944132) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is [5-[(2,5-dimethylphenoxy)methyl]-1-hexyltriazol-4-yl]methanamine.
| Compound Name | [5-[(2,5-dimethylphenoxy)methyl]-1-hexyltriazol-4-yl]methanamine |
|---|---|
| PubChem CID | 94944132 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | [5-[(2,5-dimethylphenoxy)methyl]-1-hexyltriazol-4-yl]methanamine |
| SMILES | CCCCCCn1nnc(CN)c1COc1cc(C)ccc1C |
| InChI | InChI=1S/C18H28N4O/c1-4-5-6-7-10-22-17(16(12-19)20-21-22)13-23-18-11-14(2)8-9-15(18)3/h8-9,11H,4-7,10,12-13,19H2,1-3H3 |
| InChIKey | ZTFNAEODQHUQPN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|