C13H18N4O3S — CID 94945103
5-ethylsulfonyl-3-(3-phenoxypropyl)triazol-4-amine (PubChem CID 94945103) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-ethylsulfonyl-3-(3-phenoxypropyl)triazol-4-amine.
| Compound Name | 5-ethylsulfonyl-3-(3-phenoxypropyl)triazol-4-amine |
|---|---|
| PubChem CID | 94945103 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-ethylsulfonyl-3-(3-phenoxypropyl)triazol-4-amine |
| SMILES | CCS(=O)(=O)c1nnn(CCCOc2ccccc2)c1N |
| InChI | InChI=1S/C13H18N4O3S/c1-2-21(18,19)13-12(14)17(16-15-13)9-6-10-20-11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10,14H2,1H3 |
| InChIKey | BEMIVWXJZQRPTN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|