C16H22N4O3 — CID 94945266
propan-2-yl 5-amino-1-(4-phenoxybutyl)triazole-4-carboxylate (PubChem CID 94945266) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is propan-2-yl 5-amino-1-(4-phenoxybutyl)triazole-4-carboxylate.
| Compound Name | propan-2-yl 5-amino-1-(4-phenoxybutyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 94945266 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | propan-2-yl 5-amino-1-(4-phenoxybutyl)triazole-4-carboxylate |
| SMILES | CC(C)OC(=O)c1nnn(CCCCOc2ccccc2)c1N |
| InChI | InChI=1S/C16H22N4O3/c1-12(2)23-16(21)14-15(17)20(19-18-14)10-6-7-11-22-13-8-4-3-5-9-13/h3-5,8-9,12H,6-7,10-11,17H2,1-2H3 |
| InChIKey | GVZRLQMDILYANA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|