C17H23N3O3 — CID 94945157
5-tert-butyl-1-[3-(3-methylphenoxy)propyl]triazole-4-carboxylic acid (PubChem CID 94945157) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-tert-butyl-1-[3-(3-methylphenoxy)propyl]triazole-4-carboxylic acid.
| Compound Name | 5-tert-butyl-1-[3-(3-methylphenoxy)propyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94945157 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 5-tert-butyl-1-[3-(3-methylphenoxy)propyl]triazole-4-carboxylic acid |
| SMILES | Cc1cccc(OCCCn2nnc(C(=O)O)c2C(C)(C)C)c1 |
| InChI | InChI=1S/C17H23N3O3/c1-12-7-5-8-13(11-12)23-10-6-9-20-15(17(2,3)4)14(16(21)22)18-19-20/h5,7-8,11H,6,9-10H2,1-4H3,(H,21,22) |
| InChIKey | FWICYMBQXBWUOV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|